| Place of Origin: | China |
|---|---|
| Brand Name: | First |
| Certification: | COA |
| Model Number: | 20320-59-6 |
| Minimum Order Quantity: | 1KG |
| Price: | 50-100USD |
| Packaging Details: | 1kg/bag ;25kg/drum,25 kg/Carton |
| Delivery Time: | 5 to 10 days |
| Payment Terms: | L/C, D/A, D/P, T/T, Western Union, ,BTC |
| Supply Ability: | 1000 Tons |
| Product Name: | Diethyl(phenylacetyl)malonate | Cas No.: | 20320-59-6 |
|---|---|---|---|
| MF: | C15H18O5 | EINECS No.: | 205-854-1 |
| Purity: | 99.0%min | Sample: | Availiable |
| Use: | Intermediates In Organic Synthesis. | Synonyms: | Diethyl 2-(2-phenylacetyl)propanedioate |
| Highlight: | BMK Intermediate Oil,Intermediate Oil CAS 20320-59-6,BMK Propanedioic Acid |
||
|
Product Name: |
Diethyl 2-(2-phenylacetyl)propanedioate |
| Synonyms: | Diethyl(phenylacetyl)malonate;Propanedioic acid, 2-(2-phenylacetyl)-, 1,3-diethyl ester;diethyl 2-(2-phenylacetyl)propanedioate;Cas 20320-59-6;new p |
| CAS: | 20320-59-6 |
| MF: | C15H18O5 |
| MW: | 278.3 |
| EINECS: | 205-854-1 |
| Use | Intermediates in organic synthesis. |
|
Boiling point |
120 °C(Press: 0.01 Torr) |
|
density |
1.148±0.06 g/cm3(Predicted) |
|
pka |
8.76±0.59(Predicted) |
|
InChI |
InChI=1S/C15H18O5/c1-3-19-14(17)13(15(18)20-4-2)12(16)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3 |
|
InChIKey |
ZASPDQDIPTZTQQ-UHFFFAOYSA-N |
|
SMILES |
C(OCC)(=O)C(C(CC1=CC=CC=C1)=O)C(OCC)=O |
Diethyl(phenylacetyl)malonate, also known as ethyl phenylacetylmalonate or simply EPM, is a chemical
compound with the CAS number 20320-59-6. It is a colorless to pale yellow liquid with a fruity aroma and
is mainly used in the synthesis of pharmaceuticals and agrochemicals.
Overall, Diethyl(phenylacetyl)malonate is a valuable chemical compound with a variety of applications in
the pharmaceutical and agrochemical industries. Its versatility and reactivity make it a popular starting
material for the synthesis of various organic compounds, and its production and use must be carefully
monitored to ensure safety and prevent environmental contamination.
BMK (CAS 20320-59-6), also known as benzyl methyl ketone or 3-oxo-2-phenylbutanamide, is a versatile
organic compound with various positive applications. It serves as an important intermediate in the synthesis
of pharmaceuticals, fragrances, and specialty chemicals.
![]()
![]()
Packing & Delivery
Why choose us
and services
trust and support of customers
FAQ