| Place of Origin: | China |
|---|---|
| Brand Name: | First |
| Certification: | COA |
| Model Number: | 20320-59-6 |
| Minimum Order Quantity: | 1KG |
| Price: | 50-100USD |
| Packaging Details: | 1kg/bag ;25kg/drum,25 kg/Carton |
| Delivery Time: | 5 to 10 days |
| Payment Terms: | L/C, D/A, D/P, T/T, Western Union, MoneyGram,BTC |
| Supply Ability: | 1000 Tons |
| Product Name: | Diethyl(phenylacetyl)malonate | Cas: | 20320-59-6 |
|---|---|---|---|
| Purity: | 99.0%min | EINECS: | 205-854-1 |
| MF: | C15H18O5 | Appearance: | White Powder |
| Boiling Point: | 120 °C(Press: 0.01 Torr) | Density: | 1.148±0.06 G/cm3(Predicted) |
| MW: | 278.3 |
Hot Selling Purity 99% NEW BMK Powder Diethyl(phenylacetyl)malonate CAS 20320-59-6 with Safe shipping
Whatsapp/Tele/signal:
+8618140573223
Threema: F35UMZ3Y
Email:sarah@wuhanfusite.com
Chemical Properties
| Product Name: | Diethyl(phenylacetyl)malonate |
| Synonyms: | NEW BMK POWDER NEW BMK OIL BMK LIQUID Diethyl(phenylacetyl)malonate diethyl 2-(2-phenylacetyl)propanedioate Propanedioic acid, (phenylacetyl)-, diethyl ester diethyl 2-(2-phenylacetyl)propanedioate wickr bettyml Propanedioic acid, 2-(2-phenylacetyl)-, 1,3-diethyl ester Pharmaceutical intermediates Diethyl(phenylacetyl)malonate BMK |
| CAS: | 20320-59-6 |
| MF: | C15H18O5 |
| MW: | 278.3 |
| EINECS: | 205-854-1 |
| Boiling point | 120 °C(Press: 0.01 Torr) |
| density | 1.148±0.06 g/cm3(Predicted) |
| pka | 8.76±0.59(Predicted) |
| InChI | InChI=1S/C15H18O5/c1-3-19-14(17)13(15(18)20-4-2)12(16)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3 |
| InChIKey | ZASPDQDIPTZTQQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(C(CC1=CC=CC=C1)=O)C(OCC)=O |
| Uses |
Organic synthesis intermediates. |
![]()
Packing & Delivery
Why choose us
and services
trust and support of customers
![]()
FAQ