| Place of Origin: | China |
|---|---|
| Brand Name: | First |
| Certification: | COA |
| Model Number: | 877-37-2 |
| Minimum Order Quantity: | 1KG |
| Price: | 50-100USD |
| Packaging Details: | 1kg/bag ;25kg/drum,25 kg/Carton |
| Delivery Time: | 5 to 10 days |
| Payment Terms: | L/C, D/A, D/P, T/T, Western Union, ,BTC |
| Supply Ability: | 1000 Tons |
| Product Name: | 2-bromo-4-chloropropiophenone | Cas: | 877-37-2 |
|---|---|---|---|
| Purity: | 99.0%min | EINECS: | 208-460-6 |
| MF: | C9H8BrClO | Appearance: | White Powder |
| Boiling Point: | 296.7±15.0 °C(Predicted) | Flash Point: | 133.2ºC |
| Storage Condition: | Room Temprature |
Chemical Raw Materials 2-bromo-4-chloropropiophenone CAS 877-37-2 High Quality with Safety Delivery
Whatsapp/Tele/signal:
+8618140573223
Threema: F35UMZ3Y
Email:sarah@wuhanfusite.com
Chemical Properties
| Product Name: | 2-bromo-4-chloropropiophenone |
| Synonyms | 2-bromo-4-chloropropiophenone 2-Bromo-1-(4-chlorophenyl)-1-propanone 1-Propanone, 2-bromo-1-(4-chlorophenyl)- 2-Bromo-1-(4-chloro-phenyl)-propan-1-one, 2-Бром-1-(4-хлорфенил)-пропан-1-он, 2-bromo-4'-chloropropiophenone |
| CAS: | 877-37-2 |
| MF: | C9H8BrClO |
| MW: | 247.52 |
| EINECS: | 100-413-0 |
| Melting point | 77-79 °C(Solv: ligroine (8032-32-4)) |
| Boiling point | 296.7±15.0 °C(Predicted) |
| density | 1.518±0.06 g/cm3(Predicted) |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C9H8BrClO/c1-6(10)9(12)7-2-4-8(11)5-3-7/h2-6H,1H3 |
| InChIKey | SAKMPXRILWVZEG-UHFFFAOYSA-N |
![]()
Packing & Delivery
Why choose us
and services
trust and support of customers
![]()
FAQ