| Place of Origin: | China |
|---|---|
| Brand Name: | First |
| Certification: | COA |
| Model Number: | 236117-38-7 |
| Minimum Order Quantity: | 1KG |
| Price: | 50-100USD |
| Packaging Details: | 1kg/bag ;25kg/drum,25 kg/Carton |
| Delivery Time: | 5 to 10 days |
| Payment Terms: | L/C, D/A, D/P, T/T, Western Union, MoneyGram,BTC |
| Supply Ability: | 1000 Tons |
| Product Name: | 4-Amino-3,5-dichlorophenacylbromide | Cas: | 37148-47-3 |
|---|---|---|---|
| Purity: | 99.0%min | EINECS: | 253-367-6 |
| MF: | C8H6BrCl2NO | Appearance: | Yellow Powder |
| Boling Point: | 396.4±42.0 °C(Predicted) | Density: | 1.764±0.06 G/cm3(Predicted |
High Purity CAS 37148-47-3 4-Amino-3,5-dichlorophenacylbromide with 100% Safe and Fast Delivery
Whatsapp/Tele/signal:
+8618140573223
Threema: F35UMZ3Y
Email:sarah@wuhanfusite.com
Chemical Properties
| Product Name: | |
| Synonyms: | Clenbuterol EP Impurity E 4-AMino-3,5-dichloro-2broMoacetophenone 4-Amino-3,5-dichloro-alpha-bromoacetophenone 4-Amino-omega-bromo-3',5'-dichloroacetophenone Clenbuterol Impurity 5(Clenbuterol EP Impurity E) |
| CAS: | 37148-47-3 |
| MF: | C8H6BrCl2NO |
| MW: | 282.95 |
| EINECS: | 253-367-6 |
 |
|
| Melting point | 142-1450C |
| Boiling point | 396.4±42.0 °C(Predicted) |
| density | 1.764±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | -2.21±0.10(Predicted) |
| color | Off-White to Yellow |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H6BrCl2NO/c9-3-7(13)4-1-5(10)8(12)6(11)2-4/h1-2H,3,12H2 |
| InChIKey | ATKJJUFAWYSFID-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=C(N)C(Cl)=C1)CBr |
Packing & Delivery
Why choose us
and services
trust and support of customers
FAQ
