| Place of Origin: | China |
|---|---|
| Brand Name: | First |
| Certification: | COA |
| Model Number: | 28578-16-7 |
| Minimum Order Quantity: | 1KG |
| Price: | 50-100USD |
| Packaging Details: | 1kg/bag ;25kg/drum,25 kg/Carton |
| Delivery Time: | 5 to 10 days |
| Payment Terms: | L/C, D/A, D/P, T/T, Western Union, MoneyGram,BTC |
| Supply Ability: | 1000 Tons |
| Product Name: | PMK Ethyl Glycidate | Cas: | 28578-16-7 |
|---|---|---|---|
| Purity: | 99.0%min | EINECS: | 234-232-0 |
| MF: | C13H14O5 | Appearance: | White Crystalline Powder |
| Boiling Point: | 327.8±42.0 °C(Predicted) | Flash Point: | 143ºC |
| MW: | 250.25 |
Australia Canada Netherlands Germany Hot Sales CAS 28578-16-7 Pmk Powder with Best Price
Whatsapp/Tele/signal:
+8618140573223
Threema: F35UMZ3Y
Email:sarah@wuhanfusite.com
Chemical Properties
| Name | PMK ethyl glycidate |
| Synonyms |
3,4-MDP-2P ethyl ester 3,4-MDP-2-P intermediate cheap 3,4-MDP-2P ethyl ester 3-(1,3-benzodioxol-5-yl)-2-Methyl- ethyl 3-(1,3-benzodioxol-5-yl)-2-methyloxirane-2-carboxylate ethyl 3-(benzo[d][1,3]dioxol-5-yl)-2-methyloxirane-2-carboxylate 2-Oxiranecarboxylicacid, 3-(1,3-benzodioxol-5-yl)-2-Methyl-, ethyl ester PMK |
| CAS | 28578-16-7 |
| EINECS | 234-232-0 |
| InChI | InChI=1S/C13H14O5/c1-3-15-12(14)13(2)11(18-13)8-4-5-9-10(6-8)17-7-16-9/h4-6,11H,3,7H2,1-2H3 |
| InChIKey | BRILFEZHPXQINW-UHFFFAOYSA-N |
![]() |
|
| Molecular Formula | C13H14O5 |
| Molar Mass | 250.25 |
| Density | 1.302±0.06 g/cm3(Predicted) |
| Boling Point | 327.8±42.0 °C(Predicted) |
| Solubility | DMF: 15 mg/ml DMSO: 30 mg/ml Ethanol: 10 mg/ml PBS (pH 7.2): 1 mg/ml |
| Storage Condition | -20°C |
![]()
Packing & Delivery
Why choose us
and services
trust and support of customers
![]()
FAQ